C30H42Cl2N2O4 — CID 3071694
2,7-bis(morpholin-4-ylmethyl)-1,8-diphenyloctane-1,8-dione;dihydrochloride (PubChem CID 3071694) has the molecular formula C30H42Cl2N2O4 and a molecular weight of 565.58 g/mol. Its IUPAC name is 2,7-bis(morpholin-4-ylmethyl)-1,8-diphenyloctane-1,8-dione;dihydrochloride.
| Compound Name | 2,7-bis(morpholin-4-ylmethyl)-1,8-diphenyloctane-1,8-dione;dihydrochloride |
|---|---|
| PubChem CID | 3071694 |
| Molecular Formula | C30H42Cl2N2O4 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 2,7-bis(morpholin-4-ylmethyl)-1,8-diphenyloctane-1,8-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1ccccc1)C(CCCCC(CN1CCOCC1)C(=O)c1ccccc1)CN1CCOCC1 |
| InChI | InChI=1S/C30H40N2O4.2ClH/c33-29(25-9-3-1-4-10-25)27(23-31-15-19-35-20-16-31)13-7-8-14-28(24-32-17-21-36-22-18-32)30(34)26-11-5-2-6-12-26;;/h1-6,9-12,27-28H,7-8,13-24H2;2*1H |
| InChIKey | HLAHQSXQJHVZTE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|