About 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride
1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride (PubChem CID 3072071) has the molecular formula C10H15ClN2O
and a molecular weight of 214.70 g/mol. Its IUPAC name is 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride.
Molecular Properties
| Compound Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride |
| PubChem CID | 3072071 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride |
| SMILES | C#CCON=CC1=CCCN(C)C1.Cl |
| InChI | InChI=1S/C10H14N2O.ClH/c1-3-7-13-11-8-10-5-4-6-12(2)9-10;/h1,5,8H,4,6-7,9H2,2H3;1H |
| InChIKey | LSCRMWXZUHWSAX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride?
The IUPAC name of 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride (CID 3072071) is 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride.
What is the SMILES notation for 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride?
The canonical SMILES for 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride is C#CCON=CC1=CCCN(C)C1.Cl.
What is the InChIKey of 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride?
The InChIKey is LSCRMWXZUHWSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O.ClH/c1-3-7-13-11-8-10-5-4-6-12(2)9-10;/h1,5,8H,4,6-7,9H2,2H3;1H.
What are the key properties of 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride?
1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride has a molecular weight of 214.70 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-N-prop-2-ynoxymethanimine;hydrochloride is sourced from PubChem (CID 3072071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).