C23H21N3O — CID 3072145
3,4-bis(4-methylphenyl)-5-(phenoxymethyl)-1,2,4-triazole (PubChem CID 3072145) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 3,4-bis(4-methylphenyl)-5-(phenoxymethyl)-1,2,4-triazole.
| Compound Name | 3,4-bis(4-methylphenyl)-5-(phenoxymethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 3072145 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3,4-bis(4-methylphenyl)-5-(phenoxymethyl)-1,2,4-triazole |
| SMILES | Cc1ccc(-c2nnc(COc3ccccc3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O/c1-17-8-12-19(13-9-17)23-25-24-22(16-27-21-6-4-3-5-7-21)26(23)20-14-10-18(2)11-15-20/h3-15H,16H2,1-2H3 |
| InChIKey | COUDQTUIYPPCAD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |