C25H32N4O4 — CID 30722426
3-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-N-(2-phenoxyphenyl)propanamide (PubChem CID 30722426) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 3-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-N-(2-phenoxyphenyl)propanamide.
| Compound Name | 3-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-N-(2-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 30722426 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 3-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-N-(2-phenoxyphenyl)propanamide |
| SMILES | O=C(CCN1CCN(CC(=O)N2CCOCC2)CC1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C25H32N4O4/c30-24(26-22-8-4-5-9-23(22)33-21-6-2-1-3-7-21)10-11-27-12-14-28(15-13-27)20-25(31)29-16-18-32-19-17-29/h1-9H,10-20H2,(H,26,30) |
| InChIKey | XYCFGMUYDJMLBG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |