About 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one
5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 3072252) has the molecular formula C11H9FN6O
and a molecular weight of 260.23 g/mol. Its IUPAC name is 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 3072252 |
| Molecular Formula | C11H9FN6O |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Nn1c(Nc2ccc(F)cc2)nc2[nH]ncc2c1=O |
| InChI | InChI=1S/C11H9FN6O/c12-6-1-3-7(4-2-6)15-11-16-9-8(5-14-17-9)10(19)18(11)13/h1-5H,13H2,(H2,14,15,16,17) |
| InChIKey | JSDSBSMLLXHUTC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one (CID 3072252) is 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one is Nn1c(Nc2ccc(F)cc2)nc2[nH]ncc2c1=O.
What is the InChIKey of 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is JSDSBSMLLXHUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN6O/c12-6-1-3-7(4-2-6)15-11-16-9-8(5-14-17-9)10(19)18(11)13/h1-5H,13H2,(H2,14,15,16,17).
What are the key properties of 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one?
5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 260.23 g/mol, XLogP of 0.72, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(4-fluoroanilino)-1H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 3072252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).