C13H10N6OS — CID 3072263
10-(4-methoxyphenyl)-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraene-2-thione (PubChem CID 3072263) has the molecular formula C13H10N6OS and a molecular weight of 298.33 g/mol. Its IUPAC name is 10-(4-methoxyphenyl)-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraene-2-thione.
| Compound Name | 10-(4-methoxyphenyl)-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraene-2-thione |
|---|---|
| PubChem CID | 3072263 |
| Molecular Formula | C13H10N6OS |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 10-(4-methoxyphenyl)-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraene-2-thione |
| SMILES | COc1ccc(-n2cnn3c(=S)c4cn[nH]c4nc23)cc1 |
| InChI | InChI=1S/C13H10N6OS/c1-20-9-4-2-8(3-5-9)18-7-15-19-12(21)10-6-14-17-11(10)16-13(18)19/h2-7H,1H3,(H,14,17) |
| InChIKey | QMKLTYOWSWWWPN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|