About N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride
N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride (PubChem CID 3072373) has the molecular formula C13H21ClN2
and a molecular weight of 240.78 g/mol. Its IUPAC name is N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride |
| PubChem CID | 3072373 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride |
| SMILES | CN(C)CC1CCCN1c1ccccc1.Cl |
| InChI | InChI=1S/C13H20N2.ClH/c1-14(2)11-13-9-6-10-15(13)12-7-4-3-5-8-12;/h3-5,7-8,13H,6,9-11H2,1-2H3;1H |
| InChIKey | ONLXMVLRKIUZET-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride?
The IUPAC name of N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride (CID 3072373) is N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride.
What is the SMILES notation for N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride?
The canonical SMILES for N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride is CN(C)CC1CCCN1c1ccccc1.Cl.
What is the InChIKey of N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride?
The InChIKey is ONLXMVLRKIUZET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2.ClH/c1-14(2)11-13-9-6-10-15(13)12-7-4-3-5-8-12;/h3-5,7-8,13H,6,9-11H2,1-2H3;1H.
What are the key properties of N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride?
N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride has a molecular weight of 240.78 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(1-phenylpyrrolidin-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 3072373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).