About [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride
[1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 3072430) has the molecular formula C13H21ClN2
and a molecular weight of 240.78 g/mol. Its IUPAC name is [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride |
| PubChem CID | 3072430 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cc1ccc(N2CCCC2CN)cc1C.Cl |
| InChI | InChI=1S/C13H20N2.ClH/c1-10-5-6-12(8-11(10)2)15-7-3-4-13(15)9-14;/h5-6,8,13H,3-4,7,9,14H2,1-2H3;1H |
| InChIKey | VAIPMQXMEUNUDZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride?
The IUPAC name of [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride (CID 3072430) is [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride.
What is the SMILES notation for [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride?
The canonical SMILES for [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride is Cc1ccc(N2CCCC2CN)cc1C.Cl.
What is the InChIKey of [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride?
The InChIKey is VAIPMQXMEUNUDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2.ClH/c1-10-5-6-12(8-11(10)2)15-7-3-4-13(15)9-14;/h5-6,8,13H,3-4,7,9,14H2,1-2H3;1H.
What are the key properties of [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride?
[1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride has a molecular weight of 240.78 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dimethylphenyl)pyrrolidin-2-yl]methanamine;hydrochloride is sourced from PubChem (CID 3072430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).