C25H40N2O7 — CID 3073048
tert-butyl N-[(2S)-4-methyl-1-oxo-1-(2,5,11,14-tetraoxa-8-azabicyclo[13.4.0]nonadeca-1(19),15,17-trien-8-yl)pentan-2-yl]carbamate (PubChem CID 3073048) has the molecular formula C25H40N2O7 and a molecular weight of 480.60 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-methyl-1-oxo-1-(2,5,11,14-tetraoxa-8-azabicyclo[13.4.0]nonadeca-1(19),15,17-trien-8-yl)pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-(2,5,11,14-tetraoxa-8-azabicyclo[13.4.0]nonadeca-1(19),15,17-trien-8-yl)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 3073048 |
| Molecular Formula | C25H40N2O7 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-(2,5,11,14-tetraoxa-8-azabicyclo[13.4.0]nonadeca-1(19),15,17-trien-8-yl)pentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCOCCOc2ccccc2OCCOCC1 |
| InChI | InChI=1S/C25H40N2O7/c1-19(2)18-20(26-24(29)34-25(3,4)5)23(28)27-10-12-30-14-16-32-21-8-6-7-9-22(21)33-17-15-31-13-11-27/h6-9,19-20H,10-18H2,1-5H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | ISVARYPDBKLVSA-FQEVSTJZSA-N |
| XLogP | 3.26 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |