C14H20N6O2 — CID 3073192
3-methyl-N-[4-[(3-methylpyrazole-1-carbonyl)amino]butyl]pyrazole-1-carboxamide (PubChem CID 3073192) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-methyl-N-[4-[(3-methylpyrazole-1-carbonyl)amino]butyl]pyrazole-1-carboxamide.
| Compound Name | 3-methyl-N-[4-[(3-methylpyrazole-1-carbonyl)amino]butyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 3073192 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-methyl-N-[4-[(3-methylpyrazole-1-carbonyl)amino]butyl]pyrazole-1-carboxamide |
| SMILES | Cc1ccn(C(=O)NCCCCNC(=O)n2ccc(C)n2)n1 |
| InChI | InChI=1S/C14H20N6O2/c1-11-5-9-19(17-11)13(21)15-7-3-4-8-16-14(22)20-10-6-12(2)18-20/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,15,21)(H,16,22) |
| InChIKey | WJIOHMVWGVGWJW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|