About N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide
N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide (PubChem CID 3073650) has the molecular formula C17H16N4O3
and a molecular weight of 324.34 g/mol. Its IUPAC name is N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide |
| PubChem CID | 3073650 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCc2nnc(Nc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C17H16N4O3/c1-12(22)18-14-7-9-15(10-8-14)23-11-16-20-21-17(24-16)19-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | NLDOFCLGEQZBNJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide?
The IUPAC name of N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide (CID 3073650) is N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide.
What is the SMILES notation for N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide?
The canonical SMILES for N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide is CC(=O)Nc1ccc(OCc2nnc(Nc3ccccc3)o2)cc1.
What is the InChIKey of N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide?
The InChIKey is NLDOFCLGEQZBNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3/c1-12(22)18-14-7-9-15(10-8-14)23-11-16-20-21-17(24-16)19-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,18,22)(H,19,21).
What are the key properties of N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide?
N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide has a molecular weight of 324.34 g/mol, XLogP of 3.35, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(5-anilino-1,3,4-oxadiazol-2-yl)methoxy]phenyl]acetamide is sourced from PubChem (CID 3073650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).