About 2-(2,5-dimethylpyrrol-1-yl)ethanethiol
2-(2,5-dimethylpyrrol-1-yl)ethanethiol (PubChem CID 3073864) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)ethanethiol.
Molecular Properties
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)ethanethiol |
| PubChem CID | 3073864 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)ethanethiol |
| SMILES | Cc1ccc(C)n1CCS |
| InChI | InChI=1S/C8H13NS/c1-7-3-4-8(2)9(7)5-6-10/h3-4,10H,5-6H2,1-2H3 |
| InChIKey | CBMNWFJMFNLKQN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 4.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethylpyrrol-1-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylpyrrol-1-yl)ethanethiol?
The IUPAC name of 2-(2,5-dimethylpyrrol-1-yl)ethanethiol (CID 3073864) is 2-(2,5-dimethylpyrrol-1-yl)ethanethiol.
What is the SMILES notation for 2-(2,5-dimethylpyrrol-1-yl)ethanethiol?
The canonical SMILES for 2-(2,5-dimethylpyrrol-1-yl)ethanethiol is Cc1ccc(C)n1CCS.
What is the InChIKey of 2-(2,5-dimethylpyrrol-1-yl)ethanethiol?
The InChIKey is CBMNWFJMFNLKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-7-3-4-8(2)9(7)5-6-10/h3-4,10H,5-6H2,1-2H3.
What are the key properties of 2-(2,5-dimethylpyrrol-1-yl)ethanethiol?
2-(2,5-dimethylpyrrol-1-yl)ethanethiol has a molecular weight of 155.27 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylpyrrol-1-yl)ethanethiol is sourced from PubChem (CID 3073864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).