About 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one
2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one (PubChem CID 3073999) has the molecular formula C16H9FN4OS
and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one.
Molecular Properties
| Compound Name | 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one |
| PubChem CID | 3073999 |
| Molecular Formula | C16H9FN4OS |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one |
| SMILES | O=c1nc(Nc2ccccc2F)sc2nc3ccccc3nc12 |
| InChI | InChI=1S/C16H9FN4OS/c17-9-5-1-2-6-10(9)20-16-21-14(22)13-15(23-16)19-12-8-4-3-7-11(12)18-13/h1-8H,(H,20,21,22) |
| InChIKey | XHTCERDXRXDWJO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one?
The IUPAC name of 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one (CID 3073999) is 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one.
What is the SMILES notation for 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one?
The canonical SMILES for 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one is O=c1nc(Nc2ccccc2F)sc2nc3ccccc3nc12.
What is the InChIKey of 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one?
The InChIKey is XHTCERDXRXDWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9FN4OS/c17-9-5-1-2-6-10(9)20-16-21-14(22)13-15(23-16)19-12-8-4-3-7-11(12)18-13/h1-8H,(H,20,21,22).
What are the key properties of 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one?
2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one has a molecular weight of 324.34 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroanilino)-[1,3]thiazino[5,6-b]quinoxalin-4-one is sourced from PubChem (CID 3073999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).