C35H56O10 — CID 3074004
32-ethyl-14,16,18,20,22,24,26,28-octahydroxy-15,31-dimethyl-1-oxacyclodotriaconta-3,5,7,9,11,29-hexaen-2-one (PubChem CID 3074004) has the molecular formula C35H56O10 and a molecular weight of 636.82 g/mol. Its IUPAC name is 32-ethyl-14,16,18,20,22,24,26,28-octahydroxy-15,31-dimethyl-1-oxacyclodotriaconta-3,5,7,9,11,29-hexaen-2-one.
| Compound Name | 32-ethyl-14,16,18,20,22,24,26,28-octahydroxy-15,31-dimethyl-1-oxacyclodotriaconta-3,5,7,9,11,29-hexaen-2-one |
|---|---|
| PubChem CID | 3074004 |
| Molecular Formula | C35H56O10 |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 636.39 |
| IUPAC Name | 32-ethyl-14,16,18,20,22,24,26,28-octahydroxy-15,31-dimethyl-1-oxacyclodotriaconta-3,5,7,9,11,29-hexaen-2-one |
| SMILES | CCC1OC(=O)C=CC=CC=CC=CC=CCC(O)C(C)C(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)C=CC1C |
| InChI | InChI=1S/C35H56O10/c1-4-34-24(2)16-17-26(36)18-27(37)19-28(38)20-29(39)21-30(40)22-31(41)23-33(43)25(3)32(42)14-12-10-8-6-5-7-9-11-13-15-35(44)45-34/h5-13,15-17,24-34,36-43H,4,14,18-23H2,1-3H3 |
| InChIKey | WXZBVOYYWCPWLJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|