C6H8N2O2S — CID 3074209
3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazine-5,8-dione (PubChem CID 3074209) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazine-5,8-dione.
| Compound Name | 3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazine-5,8-dione |
|---|---|
| PubChem CID | 3074209 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazine-5,8-dione |
| SMILES | O=C1NCC(=O)N2CSCC12 |
| InChI | InChI=1S/C6H8N2O2S/c9-5-1-7-6(10)4-2-11-3-8(4)5/h4H,1-3H2,(H,7,10) |
| InChIKey | LYWPLTHMYVJTEA-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |