C17H23ClN4O — CID 3074382
2-(butylamino)-4-chloro-N,N-diethyl-1,8-naphthyridine-3-carboxamide (PubChem CID 3074382) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-(butylamino)-4-chloro-N,N-diethyl-1,8-naphthyridine-3-carboxamide.
| Compound Name | 2-(butylamino)-4-chloro-N,N-diethyl-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 3074382 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-(butylamino)-4-chloro-N,N-diethyl-1,8-naphthyridine-3-carboxamide |
| SMILES | CCCCNc1nc2ncccc2c(Cl)c1C(=O)N(CC)CC |
| InChI | InChI=1S/C17H23ClN4O/c1-4-7-10-20-16-13(17(23)22(5-2)6-3)14(18)12-9-8-11-19-15(12)21-16/h8-9,11H,4-7,10H2,1-3H3,(H,19,20,21) |
| InChIKey | FRNCITLUHKAKRA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|