C18H27NO4S — CID 3074528
butyl (2S)-2-[[5-(furan-2-yl)-3-oxopent-4-enyl]amino]-4-methylsulfanylbutanoate (PubChem CID 3074528) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is butyl (2S)-2-[[5-(furan-2-yl)-3-oxopent-4-enyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | butyl (2S)-2-[[5-(furan-2-yl)-3-oxopent-4-enyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3074528 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | butyl (2S)-2-[[5-(furan-2-yl)-3-oxopent-4-enyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCOC(=O)[C@H](CCSC)NCCC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C18H27NO4S/c1-3-4-12-23-18(21)17(10-14-24-2)19-11-9-15(20)7-8-16-6-5-13-22-16/h5-8,13,17,19H,3-4,9-12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | OPKAUDJMFWUKND-KRWDZBQOSA-N |
| XLogP | 3.31 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|