C9H10N2O — CID 3074542
5-amino-3-methyl-1,3-dihydroindol-2-one (PubChem CID 3074542) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-amino-3-methyl-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-3-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 3074542 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5-amino-3-methyl-1,3-dihydroindol-2-one |
| SMILES | CC1C(=O)Nc2ccc(N)cc21 |
| InChI | InChI=1S/C9H10N2O/c1-5-7-4-6(10)2-3-8(7)11-9(5)12/h2-5H,10H2,1H3,(H,11,12) |
| InChIKey | FBGWTLQPDLOENE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|