About benzhydrylidenehydrazine;hydrobromide
benzhydrylidenehydrazine;hydrobromide (PubChem CID 3074632) has the molecular formula C13H13BrN2
and a molecular weight of 277.17 g/mol. Its IUPAC name is benzhydrylidenehydrazine;hydrobromide.
Molecular Properties
| Compound Name | benzhydrylidenehydrazine;hydrobromide |
| PubChem CID | 3074632 |
| Molecular Formula | C13H13BrN2 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | benzhydrylidenehydrazine;hydrobromide |
| SMILES | Br.NN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12N2.BrH/c14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,14H2;1H |
| InChIKey | HRYMIDFMJHUPNL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylidenehydrazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylidenehydrazine;hydrobromide?
The IUPAC name of benzhydrylidenehydrazine;hydrobromide (CID 3074632) is benzhydrylidenehydrazine;hydrobromide.
What is the SMILES notation for benzhydrylidenehydrazine;hydrobromide?
The canonical SMILES for benzhydrylidenehydrazine;hydrobromide is Br.NN=C(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydrylidenehydrazine;hydrobromide?
The InChIKey is HRYMIDFMJHUPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2.BrH/c14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,14H2;1H.
What are the key properties of benzhydrylidenehydrazine;hydrobromide?
benzhydrylidenehydrazine;hydrobromide has a molecular weight of 277.17 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylidenehydrazine;hydrobromide is sourced from PubChem (CID 3074632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).