C16H20Cl2N2OS — CID 3074652
3-(3-chloro-4-pentoxyphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride (PubChem CID 3074652) has the molecular formula C16H20Cl2N2OS and a molecular weight of 359.32 g/mol. Its IUPAC name is 3-(3-chloro-4-pentoxyphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride.
| Compound Name | 3-(3-chloro-4-pentoxyphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
|---|---|
| PubChem CID | 3074652 |
| Molecular Formula | C16H20Cl2N2OS |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 3-(3-chloro-4-pentoxyphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
| SMILES | CCCCCOc1ccc(C2=CSC3=NCCN23)cc1Cl.Cl |
| InChI | InChI=1S/C16H19ClN2OS.ClH/c1-2-3-4-9-20-15-6-5-12(10-13(15)17)14-11-21-16-18-7-8-19(14)16;/h5-6,10-11H,2-4,7-9H2,1H3;1H |
| InChIKey | PPZCWYKGHVIVOL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|