About methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate
methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate (PubChem CID 3074820) has the molecular formula C16H13N3O4
and a molecular weight of 311.30 g/mol. Its IUPAC name is methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate |
| PubChem CID | 3074820 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c(C#N)c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N3O4/c1-9-12(8-17)15(14(10(2)18-9)16(20)23-3)11-6-4-5-7-13(11)19(21)22/h4-7H,1-3H3 |
| InChIKey | SRBZUTFGDOFIEM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate?
The IUPAC name of methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate (CID 3074820) is methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate?
The canonical SMILES for methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate is COC(=O)c1c(C)nc(C)c(C#N)c1-c1ccccc1[N+](=O)[O-].
What is the InChIKey of methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate?
The InChIKey is SRBZUTFGDOFIEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O4/c1-9-12(8-17)15(14(10(2)18-9)16(20)23-3)11-6-4-5-7-13(11)19(21)22/h4-7H,1-3H3.
What are the key properties of methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate?
methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate has a molecular weight of 311.30 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-cyano-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylate is sourced from PubChem (CID 3074820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).