diphenylmethanamine;pyridine-2-carboxylic acid

C19H18N2O2 — CID 3075103

IUPACdiphenylmethanamine;pyridine-2-carboxylic acid
SMILESNC(c1ccccc1)c1ccccc1.O=C(O)c1ccccn1
InChIInChI=1S/C13H13N.C6H5NO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;8-6(9)5-3-1-2-4-7-5/h1-10,13H,14H2;1-4H,(H,8,9)
InChIKeySVXAPZJTLMRPRR-UHFFFAOYSA-N
MW306.37 g/mol
LogP3.51
Rot. Bonds3

About diphenylmethanamine;pyridine-2-carboxylic acid

diphenylmethanamine;pyridine-2-carboxylic acid (PubChem CID 3075103) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is diphenylmethanamine;pyridine-2-carboxylic acid.

Molecular Properties

Compound Namediphenylmethanamine;pyridine-2-carboxylic acid
PubChem CID3075103
Molecular FormulaC19H18N2O2
Molecular Weight306.37 g/mol
Exact Mass306.14
IUPAC Namediphenylmethanamine;pyridine-2-carboxylic acid
SMILESNC(c1ccccc1)c1ccccc1.O=C(O)c1ccccn1
InChIInChI=1S/C13H13N.C6H5NO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;8-6(9)5-3-1-2-4-7-5/h1-10,13H,14H2;1-4H,(H,8,9)
InChIKeySVXAPZJTLMRPRR-UHFFFAOYSA-N
XLogP3.51
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.37
LogP ≤ 53.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze diphenylmethanamine;pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diphenylmethanamine;pyridine-2-carboxylic acid?
The IUPAC name of diphenylmethanamine;pyridine-2-carboxylic acid (CID 3075103) is diphenylmethanamine;pyridine-2-carboxylic acid.
What is the SMILES notation for diphenylmethanamine;pyridine-2-carboxylic acid?
The canonical SMILES for diphenylmethanamine;pyridine-2-carboxylic acid is NC(c1ccccc1)c1ccccc1.O=C(O)c1ccccn1.
What is the InChIKey of diphenylmethanamine;pyridine-2-carboxylic acid?
The InChIKey is SVXAPZJTLMRPRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.C6H5NO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;8-6(9)5-3-1-2-4-7-5/h1-10,13H,14H2;1-4H,(H,8,9).
What are the key properties of diphenylmethanamine;pyridine-2-carboxylic acid?
diphenylmethanamine;pyridine-2-carboxylic acid has a molecular weight of 306.37 g/mol, XLogP of 3.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanamine;pyridine-2-carboxylic acid is sourced from PubChem (CID 3075103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).