C21H23Cl2N3O — CID 3075122
1-(2,6-dichlorophenyl)-3-[2-(diethylamino)ethyliminomethyl]indol-2-ol (PubChem CID 3075122) has the molecular formula C21H23Cl2N3O and a molecular weight of 404.34 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-[2-(diethylamino)ethyliminomethyl]indol-2-ol.
| Compound Name | 1-(2,6-dichlorophenyl)-3-[2-(diethylamino)ethyliminomethyl]indol-2-ol |
|---|---|
| PubChem CID | 3075122 |
| Molecular Formula | C21H23Cl2N3O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-[2-(diethylamino)ethyliminomethyl]indol-2-ol |
| SMILES | CCN(CC)CC/N=C/c1c(O)n(-c2c(Cl)cccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C21H23Cl2N3O/c1-3-25(4-2)13-12-24-14-16-15-8-5-6-11-19(15)26(21(16)27)20-17(22)9-7-10-18(20)23/h5-11,14,27H,3-4,12-13H2,1-2H3/b24-14+ |
| InChIKey | YCPFCDWZMDIEDU-ZVHZXABRSA-N |
| XLogP | 5.40 |
| TPSA | 40.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|