About N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide
N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide (PubChem CID 3075145) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide |
| PubChem CID | 3075145 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide |
| SMILES | O=CNC(=O)CN1CCOC1=O |
| InChI | InChI=1S/C6H8N2O4/c9-4-7-5(10)3-8-1-2-12-6(8)11/h4H,1-3H2,(H,7,9,10) |
| InChIKey | YNVYVKNDHMSVRW-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide?
The IUPAC name of N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide (CID 3075145) is N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide.
What is the SMILES notation for N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide?
The canonical SMILES for N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide is O=CNC(=O)CN1CCOC1=O.
What is the InChIKey of N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide?
The InChIKey is YNVYVKNDHMSVRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c9-4-7-5(10)3-8-1-2-12-6(8)11/h4H,1-3H2,(H,7,9,10).
What are the key properties of N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide?
N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide has a molecular weight of 172.14 g/mol, XLogP of -1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-formyl-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide is sourced from PubChem (CID 3075145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).