C22H32N6O2 — CID 30751994
4-(cyclohexylcarbamoylamino)-N-methyl-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide (PubChem CID 30751994) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-methyl-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-methyl-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 30751994 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-methyl-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide |
| SMILES | C[C@H](c1ccc(-n2cncn2)cc1)N(C)C(=O)CCCNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H32N6O2/c1-17(18-10-12-20(13-11-18)28-16-23-15-25-28)27(2)21(29)9-6-14-24-22(30)26-19-7-4-3-5-8-19/h10-13,15-17,19H,3-9,14H2,1-2H3,(H2,24,26,30)/t17-/m1/s1 |
| InChIKey | NXUYAQKFAZAAHK-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|