About (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one
(2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 3075480) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| PubChem CID | 3075480 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CN(C)Cc1c(O)cc(O)c2c1O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C18H19NO4/c1-19(2)10-12-13(20)8-14(21)17-15(22)9-16(23-18(12)17)11-6-4-3-5-7-11/h3-8,16,20-21H,9-10H2,1-2H3/t16-/m0/s1 |
| InChIKey | FUDHKVXYYNBYHN-INIZCTEOSA-N |
| XLogP | 2.87 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one?
The IUPAC name of (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one (CID 3075480) is (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one?
The canonical SMILES for (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one is CN(C)Cc1c(O)cc(O)c2c1O[C@H](c1ccccc1)CC2=O.
What is the InChIKey of (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one?
The InChIKey is FUDHKVXYYNBYHN-INIZCTEOSA-N. The full InChI is InChI=1S/C18H19NO4/c1-19(2)10-12-13(20)8-14(21)17-15(22)9-16(23-18(12)17)11-6-4-3-5-7-11/h3-8,16,20-21H,9-10H2,1-2H3/t16-/m0/s1.
What are the key properties of (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one?
(2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one has a molecular weight of 313.35 g/mol, XLogP of 2.87, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-8-[(dimethylamino)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 3075480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).