About 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol
2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol (PubChem CID 3075493) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol.
Molecular Properties
| Compound Name | 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol |
| PubChem CID | 3075493 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol |
| SMILES | [O-][N+]1=Cc2ccccc2C(O)C12CCCCC2 |
| InChI | InChI=1S/C14H17NO2/c16-13-12-7-3-2-6-11(12)10-15(17)14(13)8-4-1-5-9-14/h2-3,6-7,10,13,16H,1,4-5,8-9H2 |
| InChIKey | WEOPEQDYGKXYHA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol?
The IUPAC name of 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol (CID 3075493) is 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol.
What is the SMILES notation for 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol?
The canonical SMILES for 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol is [O-][N+]1=Cc2ccccc2C(O)C12CCCCC2.
What is the InChIKey of 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol?
The InChIKey is WEOPEQDYGKXYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c16-13-12-7-3-2-6-11(12)10-15(17)14(13)8-4-1-5-9-14/h2-3,6-7,10,13,16H,1,4-5,8-9H2.
What are the key properties of 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol?
2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol has a molecular weight of 231.29 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxidospiro[4H-isoquinolin-2-ium-3,1'-cyclohexane]-4-ol is sourced from PubChem (CID 3075493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).