C23H25N3O4 — CID 30755132
[2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 30755132) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 30755132 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [2-[[2-(morpholin-4-ylmethyl)phenyl]methylamino]-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | O=C(COC(=O)c1c[nH]c2ccccc12)NCc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C23H25N3O4/c27-22(16-30-23(28)20-14-24-21-8-4-3-7-19(20)21)25-13-17-5-1-2-6-18(17)15-26-9-11-29-12-10-26/h1-8,14,24H,9-13,15-16H2,(H,25,27) |
| InChIKey | SZKVYJGMTFOVME-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |