C24H29N5O2 — CID 30755450
6-cyclopropyl-N,1,3-trimethyl-N-[(4-morpholin-4-ylphenyl)methyl]pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 30755450) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 6-cyclopropyl-N,1,3-trimethyl-N-[(4-morpholin-4-ylphenyl)methyl]pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-cyclopropyl-N,1,3-trimethyl-N-[(4-morpholin-4-ylphenyl)methyl]pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 30755450 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 6-cyclopropyl-N,1,3-trimethyl-N-[(4-morpholin-4-ylphenyl)methyl]pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C)c2nc(C3CC3)cc(C(=O)N(C)Cc3ccc(N4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C24H29N5O2/c1-16-22-20(14-21(18-6-7-18)25-23(22)28(3)26-16)24(30)27(2)15-17-4-8-19(9-5-17)29-10-12-31-13-11-29/h4-5,8-9,14,18H,6-7,10-13,15H2,1-3H3 |
| InChIKey | VXMVZIDOANFZTP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|