About 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride
2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride (PubChem CID 3075548) has the molecular formula C14H19Cl2NO4
and a molecular weight of 336.22 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride |
| PubChem CID | 3075548 |
| Molecular Formula | C14H19Cl2NO4 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride |
| SMILES | COC(=O)OCCN1CCOC(c2ccc(Cl)cc2)C1.Cl |
| InChI | InChI=1S/C14H18ClNO4.ClH/c1-18-14(17)20-9-7-16-6-8-19-13(10-16)11-2-4-12(15)5-3-11;/h2-5,13H,6-10H2,1H3;1H |
| InChIKey | HULVUTLGHCYZMU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride?
The IUPAC name of 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride (CID 3075548) is 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride.
What is the SMILES notation for 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride?
The canonical SMILES for 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride is COC(=O)OCCN1CCOC(c2ccc(Cl)cc2)C1.Cl.
What is the InChIKey of 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride?
The InChIKey is HULVUTLGHCYZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO4.ClH/c1-18-14(17)20-9-7-16-6-8-19-13(10-16)11-2-4-12(15)5-3-11;/h2-5,13H,6-10H2,1H3;1H.
What are the key properties of 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride?
2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride has a molecular weight of 336.22 g/mol, XLogP of 2.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl methyl carbonate;hydrochloride is sourced from PubChem (CID 3075548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).