C21H30N4O2 — CID 30755491
N-(3-cyclohexyloxypropyl)-6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 30755491) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 30755491 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C)c2nc(C3CC3)cc(C(=O)NCCCOC3CCCCC3)c12 |
| InChI | InChI=1S/C21H30N4O2/c1-14-19-17(13-18(15-9-10-15)23-20(19)25(2)24-14)21(26)22-11-6-12-27-16-7-4-3-5-8-16/h13,15-16H,3-12H2,1-2H3,(H,22,26) |
| InChIKey | JFDTUBPENAHEJD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|