About 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride
2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride (PubChem CID 3075562) has the molecular formula C18H26Cl2N2O3
and a molecular weight of 389.32 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride |
| PubChem CID | 3075562 |
| Molecular Formula | C18H26Cl2N2O3 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCN1CCOC(c2ccc(Cl)cc2)C1)N1CCCCC1 |
| InChI | InChI=1S/C18H25ClN2O3.ClH/c19-16-6-4-15(5-7-16)17-14-20(10-12-23-17)11-13-24-18(22)21-8-2-1-3-9-21;/h4-7,17H,1-3,8-14H2;1H |
| InChIKey | LOSXYKJMPAIVEC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride?
The IUPAC name of 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride (CID 3075562) is 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride.
What is the SMILES notation for 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride?
The canonical SMILES for 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride is Cl.O=C(OCCN1CCOC(c2ccc(Cl)cc2)C1)N1CCCCC1.
What is the InChIKey of 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride?
The InChIKey is LOSXYKJMPAIVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClN2O3.ClH/c19-16-6-4-15(5-7-16)17-14-20(10-12-23-17)11-13-24-18(22)21-8-2-1-3-9-21;/h4-7,17H,1-3,8-14H2;1H.
What are the key properties of 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride?
2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride has a molecular weight of 389.32 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)morpholin-4-yl]ethyl piperidine-1-carboxylate;hydrochloride is sourced from PubChem (CID 3075562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).