About [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride
[1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride (PubChem CID 3075798) has the molecular formula C24H32ClNO3
and a molecular weight of 417.98 g/mol. Its IUPAC name is [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride.
Molecular Properties
| Compound Name | [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride |
| PubChem CID | 3075798 |
| Molecular Formula | C24H32ClNO3 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride |
| SMILES | CCC(=O)OC1(c2ccccc2)CCN(CCCCOc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C24H31NO3.ClH/c1-2-23(26)28-24(21-11-5-3-6-12-21)15-18-25(19-16-24)17-9-10-20-27-22-13-7-4-8-14-22;/h3-8,11-14H,2,9-10,15-20H2,1H3;1H |
| InChIKey | TVCSDVBFCXMDRL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride?
The IUPAC name of [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride (CID 3075798) is [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride.
What is the SMILES notation for [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride?
The canonical SMILES for [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride is CCC(=O)OC1(c2ccccc2)CCN(CCCCOc2ccccc2)CC1.Cl.
What is the InChIKey of [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride?
The InChIKey is TVCSDVBFCXMDRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO3.ClH/c1-2-23(26)28-24(21-11-5-3-6-12-21)15-18-25(19-16-24)17-9-10-20-27-22-13-7-4-8-14-22;/h3-8,11-14H,2,9-10,15-20H2,1H3;1H.
What are the key properties of [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride?
[1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride has a molecular weight of 417.98 g/mol, XLogP of 5.21, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-phenoxybutyl)-4-phenylpiperidin-4-yl] propanoate;hydrochloride is sourced from PubChem (CID 3075798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).