About 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol
1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol (PubChem CID 3075805) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol.
Molecular Properties
| Compound Name | 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol |
| PubChem CID | 3075805 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol |
| SMILES | Cc1ccccc1C1CC(O)C(C)(O)CN1C |
| InChI | InChI=1S/C14H21NO2/c1-10-6-4-5-7-11(10)12-8-13(16)14(2,17)9-15(12)3/h4-7,12-13,16-17H,8-9H2,1-3H3 |
| InChIKey | NCLIASQWOHIWQR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol?
The IUPAC name of 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol (CID 3075805) is 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol.
What is the SMILES notation for 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol?
The canonical SMILES for 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol is Cc1ccccc1C1CC(O)C(C)(O)CN1C.
What is the InChIKey of 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol?
The InChIKey is NCLIASQWOHIWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-10-6-4-5-7-11(10)12-8-13(16)14(2,17)9-15(12)3/h4-7,12-13,16-17H,8-9H2,1-3H3.
What are the key properties of 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol?
1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol has a molecular weight of 235.33 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-(2-methylphenyl)piperidine-3,4-diol is sourced from PubChem (CID 3075805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).