C15H23NO2 — CID 3075806
6-(2,4-dimethylphenyl)-1,3-dimethylpiperidine-3,4-diol (PubChem CID 3075806) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-1,3-dimethylpiperidine-3,4-diol.
| Compound Name | 6-(2,4-dimethylphenyl)-1,3-dimethylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 3075806 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-1,3-dimethylpiperidine-3,4-diol |
| SMILES | Cc1ccc(C2CC(O)C(C)(O)CN2C)c(C)c1 |
| InChI | InChI=1S/C15H23NO2/c1-10-5-6-12(11(2)7-10)13-8-14(17)15(3,18)9-16(13)4/h5-7,13-14,17-18H,8-9H2,1-4H3 |
| InChIKey | BXHUHAQDRAWEPJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |