C16H25NO2 — CID 3075807
1,3-dimethyl-6-(2,4,5-trimethylphenyl)piperidine-3,4-diol (PubChem CID 3075807) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1,3-dimethyl-6-(2,4,5-trimethylphenyl)piperidine-3,4-diol.
| Compound Name | 1,3-dimethyl-6-(2,4,5-trimethylphenyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 3075807 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1,3-dimethyl-6-(2,4,5-trimethylphenyl)piperidine-3,4-diol |
| SMILES | Cc1cc(C)c(C2CC(O)C(C)(O)CN2C)cc1C |
| InChI | InChI=1S/C16H25NO2/c1-10-6-12(3)13(7-11(10)2)14-8-15(18)16(4,19)9-17(14)5/h6-7,14-15,18-19H,8-9H2,1-5H3 |
| InChIKey | UOTKLIXLOARMGK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |