C33H46N2O10 — CID 3075896
[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl octanoate (PubChem CID 3075896) has the molecular formula C33H46N2O10 and a molecular weight of 630.74 g/mol. Its IUPAC name is [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl octanoate.
| Compound Name | [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 3075896 |
| Molecular Formula | C33H46N2O10 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCC1CN(C(=O)c2cc(OC)c(OC)c(OC)c2)CCN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C33H46N2O10/c1-8-9-10-11-12-13-29(36)45-21-24-20-34(32(37)22-16-25(39-2)30(43-6)26(17-22)40-3)14-15-35(24)33(38)23-18-27(41-4)31(44-7)28(19-23)42-5/h16-19,24H,8-15,20-21H2,1-7H3 |
| InChIKey | HRAVCYOABUOCGK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 122.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|