C35H50N2O10 — CID 3075897
[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl decanoate (PubChem CID 3075897) has the molecular formula C35H50N2O10 and a molecular weight of 658.79 g/mol. Its IUPAC name is [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl decanoate.
| Compound Name | [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl decanoate |
|---|---|
| PubChem CID | 3075897 |
| Molecular Formula | C35H50N2O10 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCC1CN(C(=O)c2cc(OC)c(OC)c(OC)c2)CCN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C35H50N2O10/c1-8-9-10-11-12-13-14-15-31(38)47-23-26-22-36(34(39)24-18-27(41-2)32(45-6)28(19-24)42-3)16-17-37(26)35(40)25-20-29(43-4)33(46-7)30(21-25)44-5/h18-21,26H,8-17,22-23H2,1-7H3 |
| InChIKey | OYHTTZDJDLVHDP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 122.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|