C27H34N2O10 — CID 3075903
[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl acetate (PubChem CID 3075903) has the molecular formula C27H34N2O10 and a molecular weight of 546.57 g/mol. Its IUPAC name is [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl acetate.
| Compound Name | [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3075903 |
| Molecular Formula | C27H34N2O10 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl acetate |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)C(COC(C)=O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C27H34N2O10/c1-16(30)39-15-19-14-28(26(31)17-10-20(33-2)24(37-6)21(11-17)34-3)8-9-29(19)27(32)18-12-22(35-4)25(38-7)23(13-18)36-5/h10-13,19H,8-9,14-15H2,1-7H3 |
| InChIKey | KRGMLTJKLQEHOZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 122.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |