C29H38N2O10 — CID 3075911
[1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl butanoate (PubChem CID 3075911) has the molecular formula C29H38N2O10 and a molecular weight of 574.63 g/mol. Its IUPAC name is [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl butanoate.
| Compound Name | [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 3075911 |
| Molecular Formula | C29H38N2O10 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | [1,4-bis(3,4,5-trimethoxybenzoyl)piperazin-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OCC1CN(C(=O)c2cc(OC)c(OC)c(OC)c2)CCN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C29H38N2O10/c1-8-9-25(32)41-17-20-16-30(28(33)18-12-21(35-2)26(39-6)22(13-18)36-3)10-11-31(20)29(34)19-14-23(37-4)27(40-7)24(15-19)38-5/h12-15,20H,8-11,16-17H2,1-7H3 |
| InChIKey | IWRWPHXCANDKPP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 122.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |