About 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one
2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one (PubChem CID 3075984) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one |
| PubChem CID | 3075984 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one |
| SMILES | Cn1nc(-c2cccs2)n(C)c1=O |
| InChI | InChI=1S/C8H9N3OS/c1-10-7(6-4-3-5-13-6)9-11(2)8(10)12/h3-5H,1-2H3 |
| InChIKey | HWUIMHNMMNELCP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one?
The IUPAC name of 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one (CID 3075984) is 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one.
What is the SMILES notation for 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one?
The canonical SMILES for 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one is Cn1nc(-c2cccs2)n(C)c1=O.
What is the InChIKey of 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one?
The InChIKey is HWUIMHNMMNELCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-10-7(6-4-3-5-13-6)9-11(2)8(10)12/h3-5H,1-2H3.
What are the key properties of 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one?
2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one has a molecular weight of 195.25 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-5-thiophen-2-yl-1,2,4-triazol-3-one is sourced from PubChem (CID 3075984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).