About 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione
1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione (PubChem CID 3076047) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione.
Analyze 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione?
The IUPAC name of 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione (CID 3076047) is 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione.
What is the SMILES notation for 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione?
The canonical SMILES for 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione is CC12CCC3(C)OC(=O)C1C3C(=O)O2.
What is the InChIKey of 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione?
The InChIKey is VGVJHBAJIFZPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-9-3-4-10(2)6(8(12)13-9)5(9)7(11)14-10/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione?
1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione has a molecular weight of 196.20 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-5,10-dioxatricyclo[5.3.0.04,8]decane-6,9-dione is sourced from PubChem (CID 3076047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).