C42H32N4O2 — CID 3076113
1-(4-methoxyphenyl)-N-[2-[(4-methoxyphenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine (PubChem CID 3076113) has the molecular formula C42H32N4O2 and a molecular weight of 624.74 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[2-[(4-methoxyphenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine.
| Compound Name | 1-(4-methoxyphenyl)-N-[2-[(4-methoxyphenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine |
|---|---|
| PubChem CID | 3076113 |
| Molecular Formula | C42H32N4O2 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[2-[(4-methoxyphenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine |
| SMILES | COc1ccc(/C=N/c2ccc3c(c2)/C(c2ccccc2)=N\c2ccc(/N=C/c4ccc(OC)cc4)cc2/C(c2ccccc2)=N\3)cc1 |
| InChI | InChI=1S/C42H32N4O2/c1-47-35-19-13-29(14-20-35)27-43-33-17-23-39-37(25-33)41(31-9-5-3-6-10-31)46-40-24-18-34(44-28-30-15-21-36(48-2)22-16-30)26-38(40)42(45-39)32-11-7-4-8-12-32/h3-28H,1-2H3/b41-37-,42-38-,43-27+,44-28+,45-39-,45-42-,46-40-,46-41- |
| InChIKey | JBOFXJBLDQALRY-ZSYPNSATSA-N |
| XLogP | 9.86 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|