C40H26Cl2N4 — CID 3076114
1-(4-chlorophenyl)-N-[2-[(4-chlorophenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine (PubChem CID 3076114) has the molecular formula C40H26Cl2N4 and a molecular weight of 633.58 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[(4-chlorophenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[(4-chlorophenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine |
|---|---|
| PubChem CID | 3076114 |
| Molecular Formula | C40H26Cl2N4 |
| Molecular Weight | 633.58 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[(4-chlorophenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine |
| SMILES | Clc1ccc(/C=N/c2ccc3c(c2)/C(c2ccccc2)=N\c2ccc(/N=C/c4ccc(Cl)cc4)cc2/C(c2ccccc2)=N\3)cc1 |
| InChI | InChI=1S/C40H26Cl2N4/c41-31-15-11-27(12-16-31)25-43-33-19-21-37-35(23-33)39(29-7-3-1-4-8-29)45-38-22-20-34(44-26-28-13-17-32(42)18-14-28)24-36(38)40(46-37)30-9-5-2-6-10-30/h1-26H/b39-35-,40-36-,43-25+,44-26+,45-38-,45-39-,46-37-,46-40- |
| InChIKey | UMOOTOHTVAOFST-XRXDPHBRSA-N |
| XLogP | 11.15 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.58 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|