About 6-phenyl-5H-imidazo[1,2-b]pyrazole
6-phenyl-5H-imidazo[1,2-b]pyrazole (PubChem CID 3076263) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 6-phenyl-5H-imidazo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 6-phenyl-5H-imidazo[1,2-b]pyrazole |
| PubChem CID | 3076263 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 6-phenyl-5H-imidazo[1,2-b]pyrazole |
| SMILES | c1ccc(-c2cc3nccn3[nH]2)cc1 |
| InChI | InChI=1S/C11H9N3/c1-2-4-9(5-3-1)10-8-11-12-6-7-14(11)13-10/h1-8,13H |
| InChIKey | NLYRPESMFJTOLW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenyl-5H-imidazo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-5H-imidazo[1,2-b]pyrazole?
The IUPAC name of 6-phenyl-5H-imidazo[1,2-b]pyrazole (CID 3076263) is 6-phenyl-5H-imidazo[1,2-b]pyrazole.
What is the SMILES notation for 6-phenyl-5H-imidazo[1,2-b]pyrazole?
The canonical SMILES for 6-phenyl-5H-imidazo[1,2-b]pyrazole is c1ccc(-c2cc3nccn3[nH]2)cc1.
What is the InChIKey of 6-phenyl-5H-imidazo[1,2-b]pyrazole?
The InChIKey is NLYRPESMFJTOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3/c1-2-4-9(5-3-1)10-8-11-12-6-7-14(11)13-10/h1-8,13H.
What are the key properties of 6-phenyl-5H-imidazo[1,2-b]pyrazole?
6-phenyl-5H-imidazo[1,2-b]pyrazole has a molecular weight of 183.21 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-5H-imidazo[1,2-b]pyrazole is sourced from PubChem (CID 3076263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).