About 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine
3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine (PubChem CID 3076399) has the molecular formula C9H7F3N2OS
and a molecular weight of 248.23 g/mol. Its IUPAC name is 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine.
Molecular Properties
| Compound Name | 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
| PubChem CID | 3076399 |
| Molecular Formula | C9H7F3N2OS |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C9H7F3N2OS/c1-14-6-3-2-5(15-9(10,11)12)4-7(6)16-8(14)13/h2-4,13H,1H3/b13-8- |
| InChIKey | INECLHFXZHBSIL-JYRVWZFOSA-N |
| XLogP | 2.62 |
| TPSA | 38.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The IUPAC name of 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine (CID 3076399) is 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine.
What is the SMILES notation for 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The canonical SMILES for 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine is [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1C.
What is the InChIKey of 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
The InChIKey is INECLHFXZHBSIL-JYRVWZFOSA-N. The full InChI is InChI=1S/C9H7F3N2OS/c1-14-6-3-2-5(15-9(10,11)12)4-7(6)16-8(14)13/h2-4,13H,1H3/b13-8-.
What are the key properties of 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine?
3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine has a molecular weight of 248.23 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-imine is sourced from PubChem (CID 3076399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).