C20H23N3O6S — CID 30766141
methyl 3-[[2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl]amino]benzoate (PubChem CID 30766141) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is methyl 3-[[2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 30766141 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | methyl 3-[[2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NCC(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C20H23N3O6S/c1-28-20(25)15-3-2-4-17(13-15)21-14-19(24)22-16-5-7-18(8-6-16)30(26,27)23-9-11-29-12-10-23/h2-8,13,21H,9-12,14H2,1H3,(H,22,24) |
| InChIKey | AGSAOXONPFZATQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |