C23H20FN3O3 — CID 30769088
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-4-(4-oxoquinazolin-3-yl)butanamide (PubChem CID 30769088) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-4-(4-oxoquinazolin-3-yl)butanamide.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-4-(4-oxoquinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 30769088 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-4-(4-oxoquinazolin-3-yl)butanamide |
| SMILES | O=C(CCCn1cnc2ccccc2c1=O)NCc1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C23H20FN3O3/c24-17-9-7-16(8-10-17)21-12-11-18(30-21)14-25-22(28)6-3-13-27-15-26-20-5-2-1-4-19(20)23(27)29/h1-2,4-5,7-12,15H,3,6,13-14H2,(H,25,28) |
| InChIKey | SWUHJZPGRAVJDT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |