C16H20F13N2O4P — CID 3077213
4-[morpholin-4-yl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phosphoryl]morpholine (PubChem CID 3077213) has the molecular formula C16H20F13N2O4P and a molecular weight of 582.29 g/mol. Its IUPAC name is 4-[morpholin-4-yl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phosphoryl]morpholine.
| Compound Name | 4-[morpholin-4-yl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phosphoryl]morpholine |
|---|---|
| PubChem CID | 3077213 |
| Molecular Formula | C16H20F13N2O4P |
| Molecular Weight | 582.29 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | 4-[morpholin-4-yl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phosphoryl]morpholine |
| SMILES | O=P(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C16H20F13N2O4P/c17-11(18,12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29)1-6-35-36(32,30-2-7-33-8-3-30)31-4-9-34-10-5-31/h1-10H2 |
| InChIKey | MYWNYBRHKQPGRM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|