3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid

C9H17NO4 — CID 3077439

IUPAC3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid
SMILESC[C@]1(O)CCOC[C@@H]1NCCC(=O)O
InChIInChI=1S/C9H17NO4/c1-9(13)3-5-14-6-7(9)10-4-2-8(11)12/h7,10,13H,2-6H2,1H3,(H,11,12)/t7-,9-/m0/s1
InChIKeyUZBZICLVTOAFGB-CBAPKCEASA-N
MW203.24 g/mol
LogP-0.41
Rot. Bonds4

About 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid

3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid (PubChem CID 3077439) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid.

Molecular Properties

Compound Name3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid
PubChem CID3077439
Molecular FormulaC9H17NO4
Molecular Weight203.24 g/mol
Exact Mass203.12
IUPAC Name3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid
SMILESC[C@]1(O)CCOC[C@@H]1NCCC(=O)O
InChIInChI=1S/C9H17NO4/c1-9(13)3-5-14-6-7(9)10-4-2-8(11)12/h7,10,13H,2-6H2,1H3,(H,11,12)/t7-,9-/m0/s1
InChIKeyUZBZICLVTOAFGB-CBAPKCEASA-N
XLogP-0.41
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 5-0.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid?
The IUPAC name of 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid (CID 3077439) is 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid.
What is the SMILES notation for 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid?
The canonical SMILES for 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid is C[C@]1(O)CCOC[C@@H]1NCCC(=O)O.
What is the InChIKey of 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid?
The InChIKey is UZBZICLVTOAFGB-CBAPKCEASA-N. The full InChI is InChI=1S/C9H17NO4/c1-9(13)3-5-14-6-7(9)10-4-2-8(11)12/h7,10,13H,2-6H2,1H3,(H,11,12)/t7-,9-/m0/s1.
What are the key properties of 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid?
3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid has a molecular weight of 203.24 g/mol, XLogP of -0.41, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3S,4S)-4-hydroxy-4-methyloxan-3-yl]amino]propanoic acid is sourced from PubChem (CID 3077439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).